Acetamide,N-[(7S)-5,6,7,9-tetrahydro-1,2,3-trimethoxy-10-(methylsulfonyl)-9-oxobenzo[a]heptalen-7-yl]- structure
|
Common Name | Acetamide,N-[(7S)-5,6,7,9-tetrahydro-1,2,3-trimethoxy-10-(methylsulfonyl)-9-oxobenzo[a]heptalen-7-yl]- | ||
|---|---|---|---|---|
| CAS Number | 2826-75-7 | Molecular Weight | 447.50100 | |
| Density | 1.35g/cm3 | Boiling Point | 813.3ºC at 760 mmHg | |
| Molecular Formula | C22H25NO7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 445.7ºC | |
| Name | N-[(7S)-1,2,3-trimethoxy-10-methylsulfonyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 813.3ºC at 760 mmHg |
| Molecular Formula | C22H25NO7S |
| Molecular Weight | 447.50100 |
| Flash Point | 445.7ºC |
| Exact Mass | 447.13500 |
| PSA | 116.38000 |
| LogP | 3.73820 |
| Vapour Pressure | 1.59E-26mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | ONNFMPUFCCPFAO-INIZCTEOSA-N |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(S(C)(=O)=O)c(=O)cc1C(NC(C)=O)CC2 |
|
~99%
Acetamide,N-[(7... CAS#:2826-75-7 |
| Literature: Quinn, Frank R.; Beisler, John A. Journal of Medicinal Chemistry, 1981 , vol. 24, # 3 p. 251 - 256 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N-((S)-10-Methansulfonyl-1,2,3-trimethoxy-9-oxo-5,6,7,9-tetrahydro-benzo[a]heptalen-7-yl)-acetamid |
| (S)-7-Acetylamino-10-methansulfonyl-6,7-dihydro-5H-benzo[a]heptalen-9-on |
| N-<5,6,7,9-tetrahydro-1,2,3-trimethoxy-9-oxo-10-(methylsulfonyl)benzo<a>heptalen-7-yl>-(S)-acetamide |
| Acetamide,6,7,9-tetrahydro-1,2,3-trimethoxy-10-(methylsulfonyl)-9-oxobenzo[a]heptalen-7-yl]-,(S) |
| (S)-7-Acetylamino-10-methansulfonyl-1,2,3-trimethoxy-6,7-dihydro-5H-benzo<a>heptalen-9-on |
| N-((S)-10-methanesulfonyl-1,2,3-trimethoxy-9-oxo-5,6,7,9-tetrahydro-benzo[a]heptalen-7-yl)-acetamide |