1-(benzenesulfonyl)-4-[4-(benzenesulfonyl)phenoxy]benzene structure
|
Common Name | 1-(benzenesulfonyl)-4-[4-(benzenesulfonyl)phenoxy]benzene | ||
|---|---|---|---|---|
| CAS Number | 28276-07-5 | Molecular Weight | 450.52700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H18O5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(benzenesulfonyl)-4-[4-(benzenesulfonyl)phenoxy]benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H18O5S2 |
|---|---|
| Molecular Weight | 450.52700 |
| Exact Mass | 450.06000 |
| PSA | 94.27000 |
| LogP | 7.30610 |
| InChIKey | UYEHYBQFYYYRJE-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)c1ccc(Oc2ccc(S(=O)(=O)c3ccccc3)cc2)cc1 |
|
~93%
1-(benzenesulfo... CAS#:28276-07-5 |
| Literature: Fukawa, Isaburo; Tanabe, Tsuneaki; Dozono, Tetsuro Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1992 , # 3 p. 377 - 382 |
|
~77%
1-(benzenesulfo... CAS#:28276-07-5 |
| Literature: Jost, Philippe; Forestiere, Alain; Sillion, Bernard; Le Perchec, Pierre Tetrahedron Letters, 1982 , vol. 23, # 42 p. 4311 - 4314 |
|
~%
1-(benzenesulfo... CAS#:28276-07-5 |
| Literature: Witt,H. et al. Angewandte Chemie, 1970 , vol. 82, p. 79 - 80 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Bis(benzene-4-sulfonylphenyl)ether |
| Benzene,1,1'-oxybis[4-(phenylsulfonyl) |