VH032-CH2-Boc structure
|
Common Name | VH032-CH2-Boc | ||
|---|---|---|---|---|
| CAS Number | 2827750-24-1 | Molecular Weight | 586.74 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H42N4O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of VH032-CH2-BocVH032-CH2-Boc is a Boc-modified VH032 (HY-120217) that serves as a ligand for VHL and recruits von Hippel-Lindau (VHL) proteins. VH032-CH2-Boc will remove the protecting group under acidic conditions and be directly used in PROTAC molecule synthesis. VH032-CH2-Boc is a key intermediate in the synthesis of PROTAC based on VHL ligand. |
| Name | VH032-CH2-Boc |
|---|
| Description | VH032-CH2-Boc is a Boc-modified VH032 (HY-120217) that serves as a ligand for VHL and recruits von Hippel-Lindau (VHL) proteins. VH032-CH2-Boc will remove the protecting group under acidic conditions and be directly used in PROTAC molecule synthesis. VH032-CH2-Boc is a key intermediate in the synthesis of PROTAC based on VHL ligand. |
|---|---|
| Related Catalog |
| Molecular Formula | C30H42N4O6S |
|---|---|
| Molecular Weight | 586.74 |
| InChIKey | XUJMZXZOAJNDDT-TVZXLZGTSA-N |
| SMILES | Cc1ncsc1-c1ccc(CNC(=O)C2CC(O)CN2C(=O)C(NC(=O)CCC(=O)OC(C)(C)C)C(C)(C)C)cc1 |