2-Propen-1-yl 3-oxo-3H-naphtho[2,1-b]pyran-2-carboxylate
Modify Date: 2026-08-25 16:38:33
![2-Propen-1-yl 3-oxo-3H-naphtho[2,1-b]pyran-2-carboxylate Structure](https://www.chemsrc.com/extcaspic/168/2829-45-0.png)
2-Propen-1-yl 3-oxo-3H-naphtho[2,1-b]pyran-2-carboxylate structure
|
Common Name | 2-Propen-1-yl 3-oxo-3H-naphtho[2,1-b]pyran-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2829-45-0 | Molecular Weight | 280.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Propen-1-yl 3-oxo-3H-naphtho[2,1-b]pyran-2-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H12O4 |
|---|---|
| Molecular Weight | 280.27 |
| InChIKey | GPMXECFIWGUURM-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)c1cc2c(ccc3ccccc32)oc1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-Propen-1-yl 3-oxo-3H-naphtho[2,1-b]pyran-2-carboxylate? |
| A: SMILES notation of 2-Propen-1-yl 3-oxo-3H-naphtho[2,1-b]pyran-2-carboxylate is C=CCOC(=O)c1cc2c(ccc3ccccc32)oc1=O. |
| Q: What is the InChIKey of 2-Propen-1-yl 3-oxo-3H-naphtho[2,1-b]pyran-2-carboxylate? |
| A: InChIKey of 2-Propen-1-yl 3-oxo-3H-naphtho[2,1-b]pyran-2-carboxylate is GPMXECFIWGUURM-UHFFFAOYSA-N. |
| Q: What is the English name of 2-Propen-1-yl 3-oxo-3H-naphtho[2,1-b]pyran-2-carboxylate? |
| A: The English name of 2-Propen-1-yl 3-oxo-3H-naphtho[2,1-b]pyran-2-carboxylate is 2-Propen-1-yl 3-oxo-3H-naphtho[2,1-b]pyran-2-carboxylate. |
| Q: What is the Chinese name of 2829-45-0? |
| A: Chinese name of 2829-45-0 is 2829-45-0. |
| Q: What is the CAS number of 2-Propen-1-yl 3-oxo-3H-naphtho[2,1-b]pyran-2-carboxylate? |
| A: CAS number of 2-Propen-1-yl 3-oxo-3H-naphtho[2,1-b]pyran-2-carboxylate is 2829-45-0. |
| Q: What is the molecular formula of 2-Propen-1-yl 3-oxo-3H-naphtho[2,1-b]pyran-2-carboxylate? |
| A: Molecular formula of 2-Propen-1-yl 3-oxo-3H-naphtho[2,1-b]pyran-2-carboxylate is C17H12O4. |
| Q: What is the molecular weight of 2-Propen-1-yl 3-oxo-3H-naphtho[2,1-b]pyran-2-carboxylate? |
| A: Molecular weight of 2-Propen-1-yl 3-oxo-3H-naphtho[2,1-b]pyran-2-carboxylate is 280.27. |