2,5-Cyclohexadiene-1,4-dione,2,5-diamino-3,6-dimethoxy
Modify Date: 2025-11-18 17:56:29
2,5-Cyclohexadiene-1,4-dione,2,5-diamino-3,6-dimethoxy structure
|
Common Name | 2,5-Cyclohexadiene-1,4-dione,2,5-diamino-3,6-dimethoxy | ||
|---|---|---|---|---|
| CAS Number | 28293-19-8 | Molecular Weight | 198.17600 | |
| Density | 1.38g/cm3 | Boiling Point | 386.2ºC at 760mmHg | |
| Molecular Formula | C8H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.4ºC | |
| Name | 2,5-diamino-3,6-dimethoxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 386.2ºC at 760mmHg |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.17600 |
| Flash Point | 221.4ºC |
| Exact Mass | 198.06400 |
| PSA | 104.64000 |
| LogP | 0.17220 |
| Vapour Pressure | 3.6E-06mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | CTWRTYUZYVCHDE-UHFFFAOYSA-N |
| SMILES | COC1=C(N)C(=O)C(OC)=C(N)C1=O |
|
~%
2,5-Cyclohexadi... CAS#:28293-19-8 |
| Literature: Zee-Cheng,K.-Y.; Cheng,C.C. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 264 - 268 |
|
~%
2,5-Cyclohexadi... CAS#:28293-19-8 |
| Literature: Neeff; Bayer Chemische Berichte, 1957 , vol. 90, p. 1137,1145 |
|
~%
2,5-Cyclohexadi... CAS#:28293-19-8 |
| Literature: Zee-Cheng,K.-Y.; Cheng,C.C. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 264 - 268 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2.5-Diamino-3.6-dimethoxy-p-benzoquinone |
| 2,5-Diamino-3,6-dimethoxy-p-benzochinon |
| 2,5-Cyclohexadiene-1,4-dione,2,5-diamino-3,6-dimethoxy |