2,5-Cyclohexadiene-1,4-dione,2,5-bis(hexylamino)-3,6-dimethyl- structure
|
Common Name | 2,5-Cyclohexadiene-1,4-dione,2,5-bis(hexylamino)-3,6-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 28293-24-5 | Molecular Weight | 334.49600 | |
| Density | 1g/cm3 | Boiling Point | 461.1ºC at 760mmHg | |
| Molecular Formula | C20H34N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.2ºC | |
| Name | 2,5-bis(hexylamino)-3,6-dimethylcyclohexa-2,5-diene-1,4-dione |
|---|
| Density | 1g/cm3 |
|---|---|
| Boiling Point | 461.1ºC at 760mmHg |
| Molecular Formula | C20H34N2O2 |
| Molecular Weight | 334.49600 |
| Flash Point | 129.2ºC |
| Exact Mass | 334.26200 |
| PSA | 58.20000 |
| LogP | 4.80780 |
| Vapour Pressure | 1.1E-08mmHg at 25°C |
| Index of Refraction | 1.505 |
| InChIKey | UIICEDRERBFHIX-UHFFFAOYSA-N |
| SMILES | CCCCCCNC1=C(C)C(=O)C(NCCCCCC)=C(C)C1=O |
|
~%
2,5-Cyclohexadi... CAS#:28293-24-5 |
| Literature: Zee-Cheng,K.-Y.; Cheng,C.C. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 264 - 268 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |