2,5-Cyclohexadiene-1,4-dione,2,5-bis(hexylamino)-3,6-dimethyl
2,5-Cyclohexadiene-1,4-dione,2,5-bis(hexylamino)-3,6-dimethyl structure
|
Common Name | 2,5-Cyclohexadiene-1,4-dione,2,5-bis(hexylamino)-3,6-dimethyl | ||
|---|---|---|---|---|
| CAS Number | 28293-24-5 | Molecular Weight | 334.49600 | |
| Density | 1g/cm3 | Boiling Point | 461.1ºC at 760mmHg | |
| Molecular Formula | C20H34N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,5-bis(hexylamino)-3,6-dimethylcyclohexa-2,5-diene-1,4-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1g/cm3 |
|---|---|
| Boiling Point | 461.1ºC at 760mmHg |
| Molecular Formula | C20H34N2O2 |
| Molecular Weight | 334.49600 |
| Flash Point | 129.2ºC |
| Exact Mass | 334.26200 |
| PSA | 58.20000 |
| LogP | 4.80780 |
| Vapour Pressure | 1.1E-08mmHg at 25°C |
| Index of Refraction | 1.505 |
| InChIKey | UIICEDRERBFHIX-UHFFFAOYSA-N |
| SMILES | CCCCCCNC1=C(C)C(=O)C(NCCCCCC)=C(C)C1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,5-Cyclohexadi... CAS#:28293-24-5 |
| Literature: Zee-Cheng,K.-Y.; Cheng,C.C. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 264 - 268 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2,5-bis(hexylamino)-3,6-dimethylcyclohexa-2,5-diene-1,4-dione? |
| A: Polar surface area (PSA) of 2,5-bis(hexylamino)-3,6-dimethylcyclohexa-2,5-diene-1,4-dione is 58.20000. |
| Q: What is the boiling point of 2,5-bis(hexylamino)-3,6-dimethylcyclohexa-2,5-diene-1,4-dione? |
| A: Boiling point of 2,5-bis(hexylamino)-3,6-dimethylcyclohexa-2,5-diene-1,4-dione is 461.1ºC at 760mmHg. |
| Q: What is the Chinese name of 28293-24-5? |
| A: Chinese name of 28293-24-5 is 28293-24-5. |
| Q: What are the upstream materials of 2,5-bis(hexylamino)-3,6-dimethylcyclohexa-2,5-diene-1,4-dione? |
| A: Related upstream materials(CAS) of 2,5-bis(hexylamino)-3,6-dimethylcyclohexa-2,5-diene-1,4-dione: 111-26-2;137-18-8. |
| Q: What is the InChIKey of 2,5-bis(hexylamino)-3,6-dimethylcyclohexa-2,5-diene-1,4-dione? |
| A: InChIKey of 2,5-bis(hexylamino)-3,6-dimethylcyclohexa-2,5-diene-1,4-dione is UIICEDRERBFHIX-UHFFFAOYSA-N. |
| Q: What is the English name of 2,5-bis(hexylamino)-3,6-dimethylcyclohexa-2,5-diene-1,4-dione? |
| A: The English name of 2,5-bis(hexylamino)-3,6-dimethylcyclohexa-2,5-diene-1,4-dione is 2,5-bis(hexylamino)-3,6-dimethylcyclohexa-2,5-diene-1,4-dione. |
| Q: What is the molecular formula of 2,5-bis(hexylamino)-3,6-dimethylcyclohexa-2,5-diene-1,4-dione? |
| A: Molecular formula of 2,5-bis(hexylamino)-3,6-dimethylcyclohexa-2,5-diene-1,4-dione is C20H34N2O2. |
| Q: What is the LogP of 2,5-bis(hexylamino)-3,6-dimethylcyclohexa-2,5-diene-1,4-dione? |
| A: LogP of 2,5-bis(hexylamino)-3,6-dimethylcyclohexa-2,5-diene-1,4-dione is 4.80780. |
| Q: What is the molecular weight of 2,5-bis(hexylamino)-3,6-dimethylcyclohexa-2,5-diene-1,4-dione? |
| A: Molecular weight of 2,5-bis(hexylamino)-3,6-dimethylcyclohexa-2,5-diene-1,4-dione is 334.49600. |
| Q: What is the CAS number of 2,5-bis(hexylamino)-3,6-dimethylcyclohexa-2,5-diene-1,4-dione? |
| A: CAS number of 2,5-bis(hexylamino)-3,6-dimethylcyclohexa-2,5-diene-1,4-dione is 28293-24-5. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |