2,5-Cyclohexadiene-1,4-dione,2,5-bis(hexylamino)-3,6-diphenyl- structure
|
Common Name | 2,5-Cyclohexadiene-1,4-dione,2,5-bis(hexylamino)-3,6-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 28293-27-8 | Molecular Weight | 458.63500 | |
| Density | 1.09g/cm3 | Boiling Point | 625.6ºC at 760mmHg | |
| Molecular Formula | C30H38N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.7ºC | |
| Name | 2,5-bis(hexylamino)-3,6-diphenylcyclohexa-2,5-diene-1,4-dione |
|---|
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 625.6ºC at 760mmHg |
| Molecular Formula | C30H38N2O2 |
| Molecular Weight | 458.63500 |
| Flash Point | 156.7ºC |
| Exact Mass | 458.29300 |
| PSA | 58.20000 |
| LogP | 7.08240 |
| Vapour Pressure | 1.44E-15mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | GDWOYOLHJUPGQK-UHFFFAOYSA-N |
| SMILES | CCCCCCNC1=C(c2ccccc2)C(=O)C(NCCCCCC)=C(c2ccccc2)C1=O |
|
~%
2,5-Cyclohexadi... CAS#:28293-27-8 |
| Literature: Zee-Cheng,K.-Y.; Cheng,C.C. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 264 - 268 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |