2-[[(1,1-Dimethylethoxy)carbonyl]amino]ethyl 3-methyl-2-butenoate
Modify Date: 2026-07-09 16:48:15
![2-[[(1,1-Dimethylethoxy)carbonyl]amino]ethyl 3-methyl-2-butenoate Structure](https://www.chemsrc.com/extcaspic/167/283159-77-3.png)
2-[[(1,1-Dimethylethoxy)carbonyl]amino]ethyl 3-methyl-2-butenoate structure
|
Common Name | 2-[[(1,1-Dimethylethoxy)carbonyl]amino]ethyl 3-methyl-2-butenoate | ||
|---|---|---|---|---|
| CAS Number | 283159-77-3 | Molecular Weight | 243.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[[(1,1-Dimethylethoxy)carbonyl]amino]ethyl 3-methyl-2-butenoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H21NO4 |
|---|---|
| Molecular Weight | 243.30 |
| InChIKey | MRUQJQCEVCWKBB-UHFFFAOYSA-N |
| SMILES | CC(C)=CC(=O)OCCNC(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-[[(1,1-Dimethylethoxy)carbonyl]amino]ethyl 3-methyl-2-butenoate? |
| A: Molecular formula of 2-[[(1,1-Dimethylethoxy)carbonyl]amino]ethyl 3-methyl-2-butenoate is C12H21NO4. |
| Q: What is the English name of 2-[[(1,1-Dimethylethoxy)carbonyl]amino]ethyl 3-methyl-2-butenoate? |
| A: The English name of 2-[[(1,1-Dimethylethoxy)carbonyl]amino]ethyl 3-methyl-2-butenoate is 2-[[(1,1-Dimethylethoxy)carbonyl]amino]ethyl 3-methyl-2-butenoate. |
| Q: What is the SMILES notation of 2-[[(1,1-Dimethylethoxy)carbonyl]amino]ethyl 3-methyl-2-butenoate? |
| A: SMILES notation of 2-[[(1,1-Dimethylethoxy)carbonyl]amino]ethyl 3-methyl-2-butenoate is CC(C)=CC(=O)OCCNC(=O)OC(C)(C)C. |
| Q: What is the molecular weight of 2-[[(1,1-Dimethylethoxy)carbonyl]amino]ethyl 3-methyl-2-butenoate? |
| A: Molecular weight of 2-[[(1,1-Dimethylethoxy)carbonyl]amino]ethyl 3-methyl-2-butenoate is 243.30. |
| Q: What is the CAS number of 2-[[(1,1-Dimethylethoxy)carbonyl]amino]ethyl 3-methyl-2-butenoate? |
| A: CAS number of 2-[[(1,1-Dimethylethoxy)carbonyl]amino]ethyl 3-methyl-2-butenoate is 283159-77-3. |
| Q: What is the Chinese name of 283159-77-3? |
| A: Chinese name of 283159-77-3 is 283159-77-3. |
| Q: What is the InChIKey of 2-[[(1,1-Dimethylethoxy)carbonyl]amino]ethyl 3-methyl-2-butenoate? |
| A: InChIKey of 2-[[(1,1-Dimethylethoxy)carbonyl]amino]ethyl 3-methyl-2-butenoate is MRUQJQCEVCWKBB-UHFFFAOYSA-N. |