valifenalate structure
|
Common Name | valifenalate | ||
|---|---|---|---|---|
| CAS Number | 283159-90-0 | Molecular Weight | 398.881 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 573.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C19H27ClN2O5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 300.5±30.1 °C | |
Use of valifenalateValifenalate(IR5885; Valiphenal), which is approved for application on high-value crops such as grapes, tomatoes and other vegetables, is effective against various types of mildew and is currently marketed primarily under the Valis moniker; insecticide agent. |
| Name | valifenalate |
|---|---|
| Synonym | More Synonyms |
| Description | Valifenalate(IR5885; Valiphenal), which is approved for application on high-value crops such as grapes, tomatoes and other vegetables, is effective against various types of mildew and is currently marketed primarily under the Valis moniker; insecticide agent. |
|---|---|
| Related Catalog |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 573.2±50.0 °C at 760 mmHg |
| Molecular Formula | C19H27ClN2O5 |
| Molecular Weight | 398.881 |
| Flash Point | 300.5±30.1 °C |
| Exact Mass | 398.160858 |
| PSA | 100.71000 |
| LogP | 3.59 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | DBXFMOWZRXXBRN-LWKPJOBUSA-N |
| SMILES | COC(=O)CC(NC(=O)C(NC(=O)OC(C)C)C(C)C)c1ccc(Cl)cc1 |
| Storage condition | 2-8℃ |
| RIDADR | NONH for all modes of transport |
|---|
| Methyl 3-(4-chlorophenyl)-3-{[N-(isopropoxycarbonyl)-L-valyl]amino}propanoate |
| Methyl-3-(4-chlorphenyl)-3-{[N-(isopropoxycarbonyl)-L-valyl]amino}propanoat |
| valifenalate |
| Methyl 3-(4-chlorophenyl)-3-{[N-(isopropoxycarbonyl)-L-valyl]amin o}propanoate |
| 1Y1&OVMYY1&1&VMYR DG&1VO1 &&L Form |
| methyl N-(isopropoxycarbonyl)-L-valyl-(3RS)-3-(4-chlorophenyl)-β-alaninate |
| valiphenal |
| Methyl N-[(1-methylethoxy)carbonyl]-L-valyl-3-(4-chlorophenyl)-β-alaninate |
| Benzenepropanoic acid, 4-chloro-β-[[(2S)-3-methyl-2-[[(1-methylethoxy)carbonyl]amino]-1-oxobutyl]amino]-, methyl ester |
| Methyl N-(isopropoxycarbonyl)-L-valyl-3-(4-chlorophenyl-β-alaninate |
| valifenate |