1,3-dimethyl-8-(pyridin-3-ylmethyl)-7H-purine-2,6-dione structure
|
Common Name | 1,3-dimethyl-8-(pyridin-3-ylmethyl)-7H-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 28345-99-5 | Molecular Weight | 271.27500 | |
| Density | 1.387g/cm3 | Boiling Point | 594.9ºC at 760mmHg | |
| Molecular Formula | C13H13N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 313.6ºC | |
| Name | 1,3-dimethyl-8-(pyridin-3-ylmethyl)-7H-purine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.387g/cm3 |
|---|---|
| Boiling Point | 594.9ºC at 760mmHg |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.27500 |
| Flash Point | 313.6ºC |
| Exact Mass | 271.10700 |
| PSA | 85.57000 |
| Vapour Pressure | 4.06E-14mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | LSUBOYQHXPRSGC-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2[nH]c(Cc3cccnc3)nc2n(C)c1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-(3-Pyridylmethyl)theophylline |
| Theophylline,8-(3-pyridylmethyl) |
| NV 4 |
| (Pyridyl-3'-methyl)-8-theophyllin |
| (Pyridyl-3' methyl)-8 theophylline [French] |
| (Pyridyl-3' methyl)-8 theophylline |
| 1,3-dimethyl-8-pyridin-3-ylmethyl-3,7(9)-dihydro-purine-2,6-dione |