4-amino-1,2-dihydroxyanthracene-9,10-dione structure
|
Common Name | 4-amino-1,2-dihydroxyanthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 2835-53-2 | Molecular Weight | 255.22600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-amino-1,2-dihydroxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H9NO4 |
|---|---|
| Molecular Weight | 255.22600 |
| Exact Mass | 255.05300 |
| PSA | 100.62000 |
| LogP | 2.03660 |
| InChIKey | RNAVBZRQFCASHH-UHFFFAOYSA-N |
| SMILES | Nc1cc(O)c(O)c2c1C(=O)c1ccccc1C2=O |
| HS Code | 2922509090 |
|---|
|
~%
4-amino-1,2-dih... CAS#:2835-53-2 |
| Literature: Hoechster Farbw. Patent: DE150322 ; |
|
~%
4-amino-1,2-dih... CAS#:2835-53-2 |
| Literature: Bayer and Co. Patent: DE268592 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 11, p. 569 |
|
~%
4-amino-1,2-dih... CAS#:2835-53-2 |
| Literature: Perkin,W.H. Journal of the Chemical Society, 1876 , vol. 30, p. 579 Jahresbericht ueber die Fortschritte der Chemie und Verwandter Theile Anderer Wissenschaften, 1877 , p. 587 |
|
~%
4-amino-1,2-dih... CAS#:2835-53-2 |
| Literature: Hoechster Farbw. Patent: DE150322 ; |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Amino-alizarin |
| Alizarine Garnet R |
| 4-Amino-1,2-dihydroxy-anthrachinon |
| Anthraquinone,4-amino-1,2-dihydroxy-(6CI,8CI) |
| AlizarineClaret R |
| 9,10-Anthracenedione,4-amino-1,2-dihydroxy |
| 4-amino-1,2-dihydroxy-9,10-anthracenedione |
| 4-amino-1,2-dihydroxy-anthraquinone |
| 1-Amino-3,4-dihydroxyanthraquinone |