3H-1,2,4-Triazole-3-thione, 1,2-dihydro-5-(phenylmethyl)- structure
|
Common Name | 3H-1,2,4-Triazole-3-thione, 1,2-dihydro-5-(phenylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 28384-40-9 | Molecular Weight | 191.25300 | |
| Density | 1.33g/cm3 | Boiling Point | 298.6ºC at 760 mmHg | |
| Molecular Formula | C9H9N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.4ºC | |
| Name | 5-Benzyl-1,2-dihydro-3H-1,2,4-triazole-3-thione |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 298.6ºC at 760 mmHg |
| Molecular Formula | C9H9N3S |
| Molecular Weight | 191.25300 |
| Flash Point | 134.4ºC |
| Exact Mass | 191.05200 |
| PSA | 80.37000 |
| LogP | 1.68420 |
| Vapour Pressure | 0.00125mmHg at 25°C |
| Index of Refraction | 1.7 |
| InChIKey | MAGFPLALYSZUTR-UHFFFAOYSA-N |
| SMILES | S=c1nc(Cc2ccccc2)[nH][nH]1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |