4-(Hydrazinecarbonyl)cyclohexane-1-carboxylic acid;hydrochloride
Modify Date: 2026-07-07 23:18:37
4-(Hydrazinecarbonyl)cyclohexane-1-carboxylic acid;hydrochloride structure
|
Common Name | 4-(Hydrazinecarbonyl)cyclohexane-1-carboxylic acid;hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2839128-93-5 | Molecular Weight | 222.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H15ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(Hydrazinecarbonyl)cyclohexane-1-carboxylic acid;hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H15ClN2O3 |
|---|---|
| Molecular Weight | 222.67 |
| InChIKey | XYZXYDQAXRPTDS-UHFFFAOYSA-N |
| SMILES | Cl.NNC(=O)C1CCC(C(=O)O)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-(Hydrazinecarbonyl)cyclohexane-1-carboxylic acid;hydrochloride? |
| A: Molecular weight of 4-(Hydrazinecarbonyl)cyclohexane-1-carboxylic acid;hydrochloride is 222.67. |
| Q: What is the English name of 4-(Hydrazinecarbonyl)cyclohexane-1-carboxylic acid;hydrochloride? |
| A: The English name of 4-(Hydrazinecarbonyl)cyclohexane-1-carboxylic acid;hydrochloride is 4-(Hydrazinecarbonyl)cyclohexane-1-carboxylic acid;hydrochloride. |
| Q: What is the molecular formula of 4-(Hydrazinecarbonyl)cyclohexane-1-carboxylic acid;hydrochloride? |
| A: Molecular formula of 4-(Hydrazinecarbonyl)cyclohexane-1-carboxylic acid;hydrochloride is C8H15ClN2O3. |
| Q: What is the SMILES notation of 4-(Hydrazinecarbonyl)cyclohexane-1-carboxylic acid;hydrochloride? |
| A: SMILES notation of 4-(Hydrazinecarbonyl)cyclohexane-1-carboxylic acid;hydrochloride is Cl.NNC(=O)C1CCC(C(=O)O)CC1. |
| Q: What is the InChIKey of 4-(Hydrazinecarbonyl)cyclohexane-1-carboxylic acid;hydrochloride? |
| A: InChIKey of 4-(Hydrazinecarbonyl)cyclohexane-1-carboxylic acid;hydrochloride is XYZXYDQAXRPTDS-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-(Hydrazinecarbonyl)cyclohexane-1-carboxylic acid;hydrochloride? |
| A: CAS number of 4-(Hydrazinecarbonyl)cyclohexane-1-carboxylic acid;hydrochloride is 2839128-93-5. |
| Q: What is the Chinese name of 2839128-93-5? |
| A: Chinese name of 2839128-93-5 is 2839128-93-5. |