Methyl 6,8-dibromo-2-methylquinoline-3-carboxylate
Modify Date: 2026-08-19 19:25:37
Methyl 6,8-dibromo-2-methylquinoline-3-carboxylate structure
|
Common Name | Methyl 6,8-dibromo-2-methylquinoline-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2839138-22-4 | Molecular Weight | 359.01 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9Br2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 6,8-dibromo-2-methylquinoline-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H9Br2NO2 |
|---|---|
| Molecular Weight | 359.01 |
| InChIKey | WOPQYQNMKIJUDN-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc2cc(Br)cc(Br)c2nc1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Methyl 6,8-dibromo-2-methylquinoline-3-carboxylate? |
| A: Molecular formula of Methyl 6,8-dibromo-2-methylquinoline-3-carboxylate is C12H9Br2NO2. |
| Q: What is the Chinese name of 2839138-22-4? |
| A: Chinese name of 2839138-22-4 is 2839138-22-4. |
| Q: What is the InChIKey of Methyl 6,8-dibromo-2-methylquinoline-3-carboxylate? |
| A: InChIKey of Methyl 6,8-dibromo-2-methylquinoline-3-carboxylate is WOPQYQNMKIJUDN-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Methyl 6,8-dibromo-2-methylquinoline-3-carboxylate? |
| A: SMILES notation of Methyl 6,8-dibromo-2-methylquinoline-3-carboxylate is COC(=O)c1cc2cc(Br)cc(Br)c2nc1C. |
| Q: What is the English name of Methyl 6,8-dibromo-2-methylquinoline-3-carboxylate? |
| A: The English name of Methyl 6,8-dibromo-2-methylquinoline-3-carboxylate is Methyl 6,8-dibromo-2-methylquinoline-3-carboxylate. |
| Q: What is the molecular weight of Methyl 6,8-dibromo-2-methylquinoline-3-carboxylate? |
| A: Molecular weight of Methyl 6,8-dibromo-2-methylquinoline-3-carboxylate is 359.01. |
| Q: What is the CAS number of Methyl 6,8-dibromo-2-methylquinoline-3-carboxylate? |
| A: CAS number of Methyl 6,8-dibromo-2-methylquinoline-3-carboxylate is 2839138-22-4. |