N,N-dimethyl-3-(trifluoromethyl)pyrrolidin-3-amine dihydrochloride
Modify Date: 2026-07-16 16:52:34
N,N-dimethyl-3-(trifluoromethyl)pyrrolidin-3-amine dihydrochloride structure
|
Common Name | N,N-dimethyl-3-(trifluoromethyl)pyrrolidin-3-amine dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2839138-85-9 | Molecular Weight | 255.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H15Cl2F3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,N-dimethyl-3-(trifluoromethyl)pyrrolidin-3-amine dihydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H15Cl2F3N2 |
|---|---|
| Molecular Weight | 255.11 |
| InChIKey | VGNVLHXUSFEVEP-UHFFFAOYSA-N |
| SMILES | CN(C)C1(C(F)(F)F)CCNC1.Cl.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N,N-dimethyl-3-(trifluoromethyl)pyrrolidin-3-amine dihydrochloride? |
| A: Molecular weight of N,N-dimethyl-3-(trifluoromethyl)pyrrolidin-3-amine dihydrochloride is 255.11. |
| Q: What is the English name of N,N-dimethyl-3-(trifluoromethyl)pyrrolidin-3-amine dihydrochloride? |
| A: The English name of N,N-dimethyl-3-(trifluoromethyl)pyrrolidin-3-amine dihydrochloride is N,N-dimethyl-3-(trifluoromethyl)pyrrolidin-3-amine dihydrochloride. |
| Q: What is the SMILES notation of N,N-dimethyl-3-(trifluoromethyl)pyrrolidin-3-amine dihydrochloride? |
| A: SMILES notation of N,N-dimethyl-3-(trifluoromethyl)pyrrolidin-3-amine dihydrochloride is CN(C)C1(C(F)(F)F)CCNC1.Cl.Cl. |
| Q: What is the InChIKey of N,N-dimethyl-3-(trifluoromethyl)pyrrolidin-3-amine dihydrochloride? |
| A: InChIKey of N,N-dimethyl-3-(trifluoromethyl)pyrrolidin-3-amine dihydrochloride is VGNVLHXUSFEVEP-UHFFFAOYSA-N. |
| Q: What is the CAS number of N,N-dimethyl-3-(trifluoromethyl)pyrrolidin-3-amine dihydrochloride? |
| A: CAS number of N,N-dimethyl-3-(trifluoromethyl)pyrrolidin-3-amine dihydrochloride is 2839138-85-9. |
| Q: What is the Chinese name of 2839138-85-9? |
| A: Chinese name of 2839138-85-9 is 2839138-85-9. |
| Q: What is the molecular formula of N,N-dimethyl-3-(trifluoromethyl)pyrrolidin-3-amine dihydrochloride? |
| A: Molecular formula of N,N-dimethyl-3-(trifluoromethyl)pyrrolidin-3-amine dihydrochloride is C7H15Cl2F3N2. |