2-[1-(Diphenylmethyl)azetidin-3-yl]-2,6-diazaspiro[3.3]heptane
Modify Date: 2026-07-14 13:42:16
![2-[1-(Diphenylmethyl)azetidin-3-yl]-2,6-diazaspiro[3.3]heptane Structure](https://www.chemsrc.com/extcaspic/191/2839156-98-6.png)
2-[1-(Diphenylmethyl)azetidin-3-yl]-2,6-diazaspiro[3.3]heptane structure
|
Common Name | 2-[1-(Diphenylmethyl)azetidin-3-yl]-2,6-diazaspiro[3.3]heptane | ||
|---|---|---|---|---|
| CAS Number | 2839156-98-6 | Molecular Weight | 319.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H25N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[1-(Diphenylmethyl)azetidin-3-yl]-2,6-diazaspiro[3.3]heptane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H25N3 |
|---|---|
| Molecular Weight | 319.4 |
| InChIKey | WFZHXBPCPCWSBQ-UHFFFAOYSA-N |
| SMILES | c1ccc(C(c2ccccc2)N2CC(N3CC4(CNC4)C3)C2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-[1-(Diphenylmethyl)azetidin-3-yl]-2,6-diazaspiro[3.3]heptane? |
| A: The English name of 2-[1-(Diphenylmethyl)azetidin-3-yl]-2,6-diazaspiro[3.3]heptane is 2-[1-(Diphenylmethyl)azetidin-3-yl]-2,6-diazaspiro[3.3]heptane. |
| Q: What is the molecular weight of 2-[1-(Diphenylmethyl)azetidin-3-yl]-2,6-diazaspiro[3.3]heptane? |
| A: Molecular weight of 2-[1-(Diphenylmethyl)azetidin-3-yl]-2,6-diazaspiro[3.3]heptane is 319.4. |
| Q: What is the InChIKey of 2-[1-(Diphenylmethyl)azetidin-3-yl]-2,6-diazaspiro[3.3]heptane? |
| A: InChIKey of 2-[1-(Diphenylmethyl)azetidin-3-yl]-2,6-diazaspiro[3.3]heptane is WFZHXBPCPCWSBQ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-[1-(Diphenylmethyl)azetidin-3-yl]-2,6-diazaspiro[3.3]heptane? |
| A: SMILES notation of 2-[1-(Diphenylmethyl)azetidin-3-yl]-2,6-diazaspiro[3.3]heptane is c1ccc(C(c2ccccc2)N2CC(N3CC4(CNC4)C3)C2)cc1. |
| Q: What is the CAS number of 2-[1-(Diphenylmethyl)azetidin-3-yl]-2,6-diazaspiro[3.3]heptane? |
| A: CAS number of 2-[1-(Diphenylmethyl)azetidin-3-yl]-2,6-diazaspiro[3.3]heptane is 2839156-98-6. |
| Q: What is the Chinese name of 2839156-98-6? |
| A: Chinese name of 2839156-98-6 is 2839156-98-6. |
| Q: What is the molecular formula of 2-[1-(Diphenylmethyl)azetidin-3-yl]-2,6-diazaspiro[3.3]heptane? |
| A: Molecular formula of 2-[1-(Diphenylmethyl)azetidin-3-yl]-2,6-diazaspiro[3.3]heptane is C21H25N3. |