4-chloro-N-(4-chlorophenyl)phthalazin-1-amine structure
|
Common Name | 4-chloro-N-(4-chlorophenyl)phthalazin-1-amine | ||
|---|---|---|---|---|
| CAS Number | 284031-04-5 | Molecular Weight | 290.14700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9Cl2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-N-(4-chlorophenyl)phthalazin-1-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H9Cl2N3 |
|---|---|
| Molecular Weight | 290.14700 |
| Exact Mass | 289.01700 |
| PSA | 37.81000 |
| LogP | 4.75320 |
| InChIKey | RAUVPXRMDTXJPQ-UHFFFAOYSA-N |
| SMILES | Clc1ccc(Nc2nnc(Cl)c3ccccc23)cc1 |
|
~74%
4-chloro-N-(4-c... CAS#:284031-04-5 |
| Literature: Duncton, Matthew A.J.; Piatnitski Chekler, Eugene L.; Katoch-Rouse, Reeti; Sherman, Dan; Wong, Wai C.; Smith II, Leon M.; Kawakami, Joel K.; Kiselyov, Alexander S.; Milligan, Daniel L.; Balagtas, Chris; Hadari, Yaron R.; Wang, Ying; Patel, Sheetal N.; Rolster, Robin L.; Tonra, James R.; Surguladze, David; Mitelman, Stan; Kussie, Paul; Bohlen, Peter; Doody, Jacqueline F. Bioorganic and Medicinal Chemistry, 2009 , vol. 17, # 2 p. 731 - 740 |
|
~%
4-chloro-N-(4-c... CAS#:284031-04-5 |
| Literature: Lim, Chae Jo; Lee, Hye In; Kim, Nakjeong; Lee, Byung Ho; Oh, Kwang-Seok; Yi, Kyu Yang Bulletin of the Korean Chemical Society, 2013 , vol. 34, # 12 p. 3851 - 3854 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| (4-chlorophenyl)-(4-chlorophthalazin-1-yl)amine |
| 1-Phthalazinamine,4-chloro-N-(4-chlorophenyl) |
| (4-Chlor-phenyl)-(4-chlor-phthalazin-1-yl)-amin |
| 1-chloro-4-(4-chlorophenylamino)-phthalazine |