Benzoic acid,3,4-dichloro-, 2-(3,4-dichlorobenzoyl)hydrazide structure
|
Common Name | Benzoic acid,3,4-dichloro-, 2-(3,4-dichlorobenzoyl)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 28455-14-3 | Molecular Weight | 378.03800 | |
| Density | 1.537g/cm3 | Boiling Point | 614.7ºC at 760 mmHg | |
| Molecular Formula | C14H8Cl4N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 325.5ºC | |
| Name | 3,4-dichloro-N'-(3,4-dichlorobenzoyl)benzohydrazide |
|---|
| Density | 1.537g/cm3 |
|---|---|
| Boiling Point | 614.7ºC at 760 mmHg |
| Molecular Formula | C14H8Cl4N2O2 |
| Molecular Weight | 378.03800 |
| Flash Point | 325.5ºC |
| Exact Mass | 375.93400 |
| PSA | 58.20000 |
| LogP | 5.15680 |
| Vapour Pressure | 4.83E-15mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | FMTOEJTZGHGOKG-UHFFFAOYSA-N |
| SMILES | O=C(NNC(=O)c1ccc(Cl)c(Cl)c1)c1ccc(Cl)c(Cl)c1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |