4(1H)-Pyrimidinone,2,3-dihydro-6-(1-methylethyl)-2-thioxo- structure
|
Common Name | 4(1H)-Pyrimidinone,2,3-dihydro-6-(1-methylethyl)-2-thioxo- | ||
|---|---|---|---|---|
| CAS Number | 28456-53-3 | Molecular Weight | 170.23200 | |
| Density | 1.23g/cm3 | Boiling Point | 344.1ºC at 760mmHg | |
| Molecular Formula | C7H10N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.9ºC | |
| Name | 6-propan-2-yl-2-sulfanylidene-1H-pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 344.1ºC at 760mmHg |
| Molecular Formula | C7H10N2OS |
| Molecular Weight | 170.23200 |
| Flash Point | 161.9ºC |
| Exact Mass | 170.05100 |
| PSA | 80.74000 |
| LogP | 1.55590 |
| Vapour Pressure | 3.39E-05mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | ZLFICLXWPLFISK-UHFFFAOYSA-N |
| SMILES | CC(C)c1cc(=O)[nH]c(=S)[nH]1 |
| HS Code | 2933599090 |
|---|
|
~46%
4(1H)-Pyrimidin... CAS#:28456-53-3 |
| Literature: GENENTECH, INC. Patent: US2010/317643 A1, 2010 ; Location in patent: Page/Page column 98 ; US 20100317643 A1 |
|
~%
4(1H)-Pyrimidin... CAS#:28456-53-3 |
| Literature: Bowden, Keith; Bright, Andrew C. Journal of Chemical Research, Miniprint, 1992 , # 2 p. 514 - 539 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-isopropyl-2-thioxo-2,3-dihydro-1H-pyrimidin-4-one |
| F1967-0507 |
| 6-Isopropylthiouracil |
| F2135-0908 |