N-Nitroso-(2,2-dinitropropyl)amine structure
|
Common Name | N-Nitroso-(2,2-dinitropropyl)amine | ||
|---|---|---|---|---|
| CAS Number | 28464-26-8 | Molecular Weight | 310.17800 | |
| Density | 1.79g/cm3 | Boiling Point | 504.1ºC at 760mmHg | |
| Molecular Formula | C6H10N6O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.6ºC | |
| Name | N,N-bis(2,2-dinitropropyl)nitrous amide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.79g/cm3 |
|---|---|
| Boiling Point | 504.1ºC at 760mmHg |
| Molecular Formula | C6H10N6O9 |
| Molecular Weight | 310.17800 |
| Flash Point | 258.6ºC |
| Exact Mass | 310.05100 |
| PSA | 215.95000 |
| LogP | 1.60180 |
| Vapour Pressure | 2.75E-10mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | PQLZMPIPNSKOKH-UHFFFAOYSA-N |
| SMILES | CC(CN(CC(C)([N+](=O)[O-])[N+](=O)[O-])N=O)([N+](=O)[O-])[N+](=O)[O-] |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Dipropylamine,2,2,2',2'-tetranitro-N-nitroso-(8CI) |
| Bis-(2,2-dinitropropyl)-nitrosamin |
| N-Nitroso-(2,2-dinitropropyl)amine |
| N-Nitroso-bis-(2,2-dinitropropyl)amine |
| 1-Propanamine,N-(2,2-dinitropropyl)-2,2-dinitro-N-nitroso |
| bis(2,2-dinitropropyl)-N-nitrosoamine |
| Bis-(2,2-dinitropropyl)-N-nitrosamin |