1-Benzyl-N,N-diethyl-1H-pyrazol-4-amine structure
|
Common Name | 1-Benzyl-N,N-diethyl-1H-pyrazol-4-amine | ||
|---|---|---|---|---|
| CAS Number | 28466-15-1 | Molecular Weight | 229.32100 | |
| Density | 1.01g/cm3 | Boiling Point | 374.2ºC at 760 mmHg | |
| Molecular Formula | C14H19N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.1ºC | |
| Name | 1-benzyl-N,N-diethylpyrazol-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 374.2ºC at 760 mmHg |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.32100 |
| Flash Point | 180.1ºC |
| Exact Mass | 229.15800 |
| PSA | 21.06000 |
| LogP | 2.77760 |
| Vapour Pressure | 8.48E-06mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | PZYHACQBECIRRD-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1cnn(Cc2ccccc2)c1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyrazole,1-benzyl-4-(diethylamino) |
| (1-benzyl-1H-pyrazol-4-yl)-diethyl-amine |
| 1-Benzyl-4-(diethylamino)pyrazole |
| 1-Benzyl-4-diethylaminopyrazol |