chloroethene,dibutyl (Z)-but-2-enedioate structure
|
Common Name | chloroethene,dibutyl (Z)-but-2-enedioate | ||
|---|---|---|---|---|
| CAS Number | 28476-83-7 | Molecular Weight | 290.78300 | |
| Density | N/A | Boiling Point | 280ºC at 760 mmHg | |
| Molecular Formula | C14H23ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.4ºC | |
| Name | chloroethene,dibutyl (Z)-but-2-enedioate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 280ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H23ClO4 |
| Molecular Weight | 290.78300 |
| Flash Point | 136.4ºC |
| Exact Mass | 290.12800 |
| PSA | 52.60000 |
| LogP | 3.59790 |
| Vapour Pressure | 0.00388mmHg at 25°C |
| InChIKey | TVYGPIVEDSXWTI-CFYXSCKTSA-N |
| SMILES | C=CCl.CCCCOC(=O)C=CC(=O)OCCCC |
| 2-Butenedioic acid (Z)-,dibutyl ester,polymer with chloroethene |
| 2-Butenedioic acid (2Z)-,dibutyl ester,polymer with chloroethene |
| 2-Butenedioc acid (Z),dibutyl ester,chloroethene polymer |
| 2-Butenedioic acid (2Z)-,1,4-dibutyl ester,polymer with chloroethene |