N-(2-benzoyl-4-chlorophenyl)-2-bromo-N-methylacetamide structure
|
Common Name | N-(2-benzoyl-4-chlorophenyl)-2-bromo-N-methylacetamide | ||
|---|---|---|---|---|
| CAS Number | 2848-94-4 | Molecular Weight | 366.63700 | |
| Density | 1.5g/cm3 | Boiling Point | 520ºC at 760 mmHg | |
| Molecular Formula | C16H13BrClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.3ºC | |
| Name | N-(2-benzoyl-4-chlorophenyl)-2-bromo-N-methylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 520ºC at 760 mmHg |
| Molecular Formula | C16H13BrClNO2 |
| Molecular Weight | 366.63700 |
| Flash Point | 268.3ºC |
| Exact Mass | 364.98200 |
| PSA | 37.38000 |
| LogP | 3.92870 |
| Vapour Pressure | 6.51E-11mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | ATRGENZZRLPDFV-UHFFFAOYSA-N |
| SMILES | CN(C(=O)CBr)c1ccc(Cl)cc1C(=O)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(p-Toluolsulfonamido)-5-chlorbenzophenon |
| N-(2-benzoyl-4-chloro-phenyl)-2-bromo-N-methyl-acetamide |
| EINECS 220-652-1 |
| 2-(2-bromo-N-methylacetamido)-5-chlorobenzophenone |
| 2-(N-methyl-bromoacetamido)-5-chlorobenzophenone |
| 5-Chlor-2-<N-methyl-bromacetamino>-benzophenon |
| 2-<Bromacetyl-N-methylamino>-5-chlor-benzophenon |
| Acetamide,N-(2-benzoyl-4-chlorophenyl)-2-bromo-N-methyl |