Ethyl 2-(4-(1,1-difluoroethyl)-3-fluorophenyl)acetate
Modify Date: 2026-08-22 19:06:07
Ethyl 2-(4-(1,1-difluoroethyl)-3-fluorophenyl)acetate structure
|
Common Name | Ethyl 2-(4-(1,1-difluoroethyl)-3-fluorophenyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 2848722-30-3 | Molecular Weight | 246.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 2-(4-(1,1-difluoroethyl)-3-fluorophenyl)acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H13F3O2 |
|---|---|
| Molecular Weight | 246.22 |
| InChIKey | JIUFNQBIOHUNHL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1ccc(C(C)(F)F)c(F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Ethyl 2-(4-(1,1-difluoroethyl)-3-fluorophenyl)acetate? |
| A: SMILES notation of Ethyl 2-(4-(1,1-difluoroethyl)-3-fluorophenyl)acetate is CCOC(=O)Cc1ccc(C(C)(F)F)c(F)c1. |
| Q: What is the InChIKey of Ethyl 2-(4-(1,1-difluoroethyl)-3-fluorophenyl)acetate? |
| A: InChIKey of Ethyl 2-(4-(1,1-difluoroethyl)-3-fluorophenyl)acetate is JIUFNQBIOHUNHL-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2848722-30-3? |
| A: Chinese name of 2848722-30-3 is 2848722-30-3. |
| Q: What is the English name of Ethyl 2-(4-(1,1-difluoroethyl)-3-fluorophenyl)acetate? |
| A: The English name of Ethyl 2-(4-(1,1-difluoroethyl)-3-fluorophenyl)acetate is Ethyl 2-(4-(1,1-difluoroethyl)-3-fluorophenyl)acetate. |
| Q: What is the molecular formula of Ethyl 2-(4-(1,1-difluoroethyl)-3-fluorophenyl)acetate? |
| A: Molecular formula of Ethyl 2-(4-(1,1-difluoroethyl)-3-fluorophenyl)acetate is C12H13F3O2. |
| Q: What is the molecular weight of Ethyl 2-(4-(1,1-difluoroethyl)-3-fluorophenyl)acetate? |
| A: Molecular weight of Ethyl 2-(4-(1,1-difluoroethyl)-3-fluorophenyl)acetate is 246.22. |
| Q: What is the CAS number of Ethyl 2-(4-(1,1-difluoroethyl)-3-fluorophenyl)acetate? |
| A: CAS number of Ethyl 2-(4-(1,1-difluoroethyl)-3-fluorophenyl)acetate is 2848722-30-3. |