2-Butenamide,N-[[[(4-methoxyphenyl)sulfonyl]amino]carbonyl]-3-methyl structure
|
Common Name | 2-Butenamide,N-[[[(4-methoxyphenyl)sulfonyl]amino]carbonyl]-3-methyl | ||
|---|---|---|---|---|
| CAS Number | 28490-30-4 | Molecular Weight | 312.34200 | |
| Density | 1.285g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H16N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(4-methoxyphenyl)sulfonylcarbamoyl]-3-methylbut-2-enamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.285g/cm3 |
|---|---|
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.34200 |
| Exact Mass | 312.07800 |
| PSA | 109.95000 |
| LogP | 3.03850 |
| Index of Refraction | 1.545 |
| InChIKey | RLUPSBIAGPFUQF-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)NC(=O)NC(=O)C=C(C)C)cc1 |
|
~%
2-Butenamide,N-... CAS#:28490-30-4 |
| Literature: Pala,G. et al. Journal of Medicinal Chemistry, 1970 , vol. 13, # 3 p. 556 - 557 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Butenamide,N-[[[(4-methoxyphenyl)sulfonyl]amino]carbonyl]-3-methyl |
| N-[(4-METHOXYPHENYL)SULFONYLCARBAMOYL]-3-METHYL-BUT-2-ENAMIDE |
| 1-[(p-methoxyphenyl)sulfonyl]-3-(3-methylcrotonoyl)-urea |
| Urea,1-[(p-methoxyphenyl)sulfonyl]-3-(3-methylcrotonoyl)-(8CI) |