1-Methoxy-3-hydroxy-9,10-anthracenedione structure
|
Common Name | 1-Methoxy-3-hydroxy-9,10-anthracenedione | ||
|---|---|---|---|---|
| CAS Number | 28504-24-7 | Molecular Weight | 254.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-hydroxy-1-methoxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H10O4 |
|---|---|
| Molecular Weight | 254.23700 |
| Exact Mass | 254.05800 |
| PSA | 63.60000 |
| LogP | 2.17620 |
| InChIKey | DUOHXWPFZBYSNM-UHFFFAOYSA-N |
| SMILES | COc1cc(O)cc2c1C(=O)c1ccccc1C2=O |
| HS Code | 2914690090 |
|---|
|
~%
1-Methoxy-3-hyd... CAS#:28504-24-7 |
| Literature: Perkin; Storey Journal of the Chemical Society, 1928 , p. 243 |
|
~%
1-Methoxy-3-hyd... CAS#:28504-24-7 |
| Literature: Fester; Suarez; Huck Rev.Fac.Quim.Santa Fe, 1945 , vol. 14, p. 163,167 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914690090 |
|---|---|
| Summary | 2914690090 other quinones。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 3-Hydroxy-1-methoxy-anthrachinon |
| 3-Hydroxy-1-methoxyanthra-9,10-quinone |
| xantopurpurin 1-methyl ether |
| 1-methoxy-3-hydroxyanthraquinone |
| 1-Methoxy-3-hydroxy-9,10-anthracenedione |
| 3-Hydroxy-1-methoxyanthraquinone |
| 1-methoxy-3-hydroxy-9,10-anthraquinone |