2,2-dimethylpropane-1,3-diyl 2-ethylhexanoate structure
|
Common Name | 2,2-dimethylpropane-1,3-diyl 2-ethylhexanoate | ||
|---|---|---|---|---|
| CAS Number | 28510-23-8 | Molecular Weight | 356.54000 | |
| Density | 0.931g/cm3 | Boiling Point | 422.6ºC at 760 mmHg | |
| Molecular Formula | C21H40O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.8ºC | |
| Name | 2,2-dimethylpropane-1,3-diyl 2-ethylhexanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.931g/cm3 |
|---|---|
| Boiling Point | 422.6ºC at 760 mmHg |
| Molecular Formula | C21H40O4 |
| Molecular Weight | 356.54000 |
| Flash Point | 195.8ºC |
| Exact Mass | 356.29300 |
| PSA | 52.60000 |
| LogP | 5.53180 |
| Vapour Pressure | 2.39E-07mmHg at 25°C |
| Index of Refraction | 1.449 |
| InChIKey | GORMSINSWZJIKL-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)C(=O)OCC(C)(C)COC(=O)C(CC)CCCC |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 1,3-bis-(2-ethyl-hexanoyloxy)-2,2-dimethyl-propane |
| 2-ethyl-hexanoic acid 3-(2-ethyl-hexanolyoxy)-2,2-dimethyl-propyl ester |
| 2,2-dimethyl-1,3-propane-diol bis(2-ethylhexanoate) |
| Hexanoic acid,2-ethyl-,2,2-dimethyl-1,3-propanediyl ester |
| 2,2-Dimethyl-1,3-propanediol diisooctanoate |
| 2,2-Dimethyl-1,3-propylene bis(2-ethylhexanoate) |
| Bis(2-ethylhexanoic acid)2,2-dimethyl-1,3-propanediyl ester |
| 1,3-Bis-(2-aethyl-hexanoyloxy)-2,2-dimethyl-propan |
| NEOPENTYL GLYCOL DIETHYLHEXANOATE |
| neopentyl glycol di(2-ethyl hexanoate) |
| 2-Ethylhexanoic acid,2,2-dimethyl-1,3-propanediyl ester |
| 2,2-Dimethylpropan-1,3-diyl-2-ethylhexanoat |