4-nitro-4'-(acetylamino)biphenyl structure
|
Common Name | 4-nitro-4'-(acetylamino)biphenyl | ||
|---|---|---|---|---|
| CAS Number | 28533-02-0 | Molecular Weight | 256.25700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-(4-nitrophenyl)phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12N2O3 |
|---|---|
| Molecular Weight | 256.25700 |
| Exact Mass | 256.08500 |
| PSA | 78.41000 |
| LogP | 4.39290 |
| InChIKey | BVLPGPPHLSHWBG-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(-c2ccc([N+](=O)[O-])cc2)cc1 |
| HS Code | 2924299090 |
|---|
|
~93%
4-nitro-4'-(ace... CAS#:28533-02-0 |
| Literature: Kitamura, Yoshiaki; Sakurai, Ai; Udzu, Takahiro; Maegawa, Tomohiro; Monguchi, Yasunari; Sajiki, Hironao Tetrahedron, 2007 , vol. 63, # 43 p. 10596 - 10602 |
|
~%
4-nitro-4'-(ace... CAS#:28533-02-0 |
| Literature: Monge, Antonio; Palop, Juan A.; Cerain, Adela Lopez de; Senador, Virginia; Martinez-Crespo, Francisko J.; et al. Journal of Medicinal Chemistry, 1995 , vol. 38, # 10 p. 1786 - 1792 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ACETAMIDE,N-(4'-NITRO(1,1'-BIPHENYL)-4-YL) |
| N-(4'-Nitro(1,1'-biphenyl)-4-yl)acetamide |
| N-(4'-Nitro-biphenyl-4-yl)-acetamid |
| 4'-Nitro-4-acetamido-biphenyl |
| 4'-Nitro-4-acetamino-diphenyl |
| 4'-nitrobiphenyl-4-acetanilide |
| 4-Nitro-4'-(acetylamino)biphenyl |
| N-(4'-nitro-biphenyl-4-yl)-acetamide |
| 4'-Nitro-4-biphenylacetanilid |
| 4-acetamido-4'-nitrobiphenyl |