4-methoxyphenyl alpha-d-mannopyranoside
Modify Date: 2025-08-27 17:37:22
4-methoxyphenyl alpha-d-mannopyranoside structure
|
Common Name | 4-methoxyphenyl alpha-d-mannopyranoside | ||
|---|---|---|---|---|
| CAS Number | 28541-75-5 | Molecular Weight | 286.27800 | |
| Density | 1.427g/cm3 | Boiling Point | 519ºC at 760 mmHg | |
| Molecular Formula | C13H18O7 | Melting Point | 154.0 to 158.0 °C | |
| MSDS | N/A | Flash Point | 267.7ºC | |
| Name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(4-methoxyphenoxy)oxane-3,4,5-triol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.427g/cm3 |
|---|---|
| Boiling Point | 519ºC at 760 mmHg |
| Melting Point | 154.0 to 158.0 °C |
| Molecular Formula | C13H18O7 |
| Molecular Weight | 286.27800 |
| Flash Point | 267.7ºC |
| Exact Mass | 286.10500 |
| PSA | 108.61000 |
| Vapour Pressure | 1.34E-11mmHg at 25°C |
| Index of Refraction | 1.6 |
| InChIKey | SIXFVXJMCGPTRB-BNDIWNMDSA-N |
| SMILES | COc1ccc(OC2OC(CO)C(O)C(O)C2O)cc1 |
| Storage condition | Freezer |
|
Name: Inhibition of Escherichia coli FimH-mediated hemagglutinination of guinea pig red blo...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1177272
|
Total 1, Current Page 1 of 1
1
| 4-Methoxyphenyl α-D-Mannopyranoside |
| p-Methoxyphenyl a-D-mannopyranoside |
| M1646 |
| 4-Methoxyphenyl a-D-mannopyranoside |