Maleic anhydride, tetrabromophthalic anhydride, propylene glycol polymer structure
|
Common Name | Maleic anhydride, tetrabromophthalic anhydride, propylene glycol polymer | ||
|---|---|---|---|---|
| CAS Number | 28574-50-7 | Molecular Weight | 637.85100 | |
| Density | N/A | Boiling Point | 540.5ºC at 760mmHg | |
| Molecular Formula | C15H10Br4O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.7ºC | |
| Name | furan-2,5-dione,propane-1,2-diol,4,5,6,7-tetrabromo-2-benzofuran-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 540.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C15H10Br4O8 |
| Molecular Weight | 637.85100 |
| Flash Point | 280.7ºC |
| Exact Mass | 633.71100 |
| PSA | 127.20000 |
| LogP | 3.03270 |
| Vapour Pressure | 9.54E-12mmHg at 25°C |
| InChIKey | SNWPTGGXKFNJEH-UHFFFAOYSA-N |
| SMILES | CC(O)CO.O=C1C=CC(=O)O1.O=C1OC(=O)c2c(Br)c(Br)c(Br)c(Br)c21 |
| 1,3-Isobenzofurandione,4,5,6,7-tetrabromo-,polymer with 2,5-furandione and 1,2-propanediol |
| Maleic anhydride,tetrabromophthalic anhydride,propylene glycol polymer |
| 4,5,6,7-tetrabromoisobenzofuran-1,3-dione |