Acetamide,N-[4-chloro-2-(hydroxyphenylmethyl)phenyl] structure
|
Common Name | Acetamide,N-[4-chloro-2-(hydroxyphenylmethyl)phenyl] | ||
|---|---|---|---|---|
| CAS Number | 28586-46-1 | Molecular Weight | 275.73000 | |
| Density | 1.299g/cm3 | Boiling Point | 488.6ºC at 760 mmHg | |
| Molecular Formula | C15H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.3ºC | |
| Name | N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]acetamide |
|---|
| Density | 1.299g/cm3 |
|---|---|
| Boiling Point | 488.6ºC at 760 mmHg |
| Molecular Formula | C15H14ClNO2 |
| Molecular Weight | 275.73000 |
| Flash Point | 249.3ºC |
| Exact Mass | 275.07100 |
| PSA | 49.33000 |
| LogP | 3.45310 |
| Vapour Pressure | 2.31E-10mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | HYWIXJPRLIEAMX-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(Cl)cc1C(O)c1ccccc1 |
|
~81%
Acetamide,N-[4-... CAS#:28586-46-1 |
| Literature: Bakibaev; Shtrykova; Vostretsov Russian Journal of Organic Chemistry, 1997 , vol. 33, # 4 p. 457 - 459 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |