Acetamide,N-[4-chloro-2-(hydroxyphenylmethyl)phenyl]
![Acetamide,N-[4-chloro-2-(hydroxyphenylmethyl)phenyl] Structure](https://image.chemsrc.com/caspic/414/28586-46-1.png)
Acetamide,N-[4-chloro-2-(hydroxyphenylmethyl)phenyl] structure
|
Common Name | Acetamide,N-[4-chloro-2-(hydroxyphenylmethyl)phenyl] | ||
|---|---|---|---|---|
| CAS Number | 28586-46-1 | Molecular Weight | 275.73000 | |
| Density | 1.299g/cm3 | Boiling Point | 488.6ºC at 760 mmHg | |
| Molecular Formula | C15H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.3ºC | |
Summary: Acetamide, N-[4-chloro-2-(hydroxyphenylmethyl)phenyl] (Chinese name: N-[4-氯-2-(苯基甲氧基)苯基]乙酰胺), CAS number: 28586-46-1, molecular formula: C15H14ClNO2, molecular weight: 275.73, For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.299g/cm3 |
|---|---|
| Boiling Point | 488.6ºC at 760 mmHg |
| Molecular Formula | C15H14ClNO2 |
| Molecular Weight | 275.73000 |
| Flash Point | 249.3ºC |
| Exact Mass | 275.07100 |
| PSA | 49.33000 |
| LogP | 3.45310 |
| Vapour Pressure | 2.31E-10mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | HYWIXJPRLIEAMX-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(Cl)cc1C(O)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~81%
Acetamide,N-[4-... CAS#:28586-46-1 |
| Literature: Bakibaev; Shtrykova; Vostretsov Russian Journal of Organic Chemistry, 1997 , vol. 33, # 4 p. 457 - 459 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]acetamide? |
| A: InChIKey of N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]acetamide is HYWIXJPRLIEAMX-UHFFFAOYSA-N. |
| Q: What is the molecular weight of N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]acetamide? |
| A: Molecular weight of N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]acetamide is 275.73000. |
| Q: What is the English name of N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]acetamide? |
| A: The English name of N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]acetamide is N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]acetamide. |
| Q: What is the Chinese name of 28586-46-1? |
| A: Chinese name of 28586-46-1 is 28586-46-1. |
| Q: What is the SMILES notation of N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]acetamide? |
| A: SMILES notation of N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]acetamide is CC(=O)Nc1ccc(Cl)cc1C(O)c1ccccc1. |
| Q: What is the CAS number of N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]acetamide? |
| A: CAS number of N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]acetamide is 28586-46-1. |
| Q: What is the LogP of N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]acetamide? |
| A: LogP of N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]acetamide is 3.45310. |
| Q: What is the molecular formula of N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]acetamide? |
| A: Molecular formula of N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]acetamide is C15H14ClNO2. |
| Q: What is the boiling point of N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]acetamide? |
| A: Boiling point of N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]acetamide is 488.6ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]acetamide? |
| A: Polar surface area (PSA) of N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]acetamide is 49.33000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |