Bis(2,5-dimethyl-3-furyl)disulfide structure
|
Common Name | Bis(2,5-dimethyl-3-furyl)disulfide | ||
|---|---|---|---|---|
| CAS Number | 28588-73-0 | Molecular Weight | 254.36800 | |
| Density | 1.23g/cm3 | Boiling Point | 305.3ºC at 760mmHg | |
| Molecular Formula | C12H14O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.5ºC | |
| Name | 3-[(2,5-dimethylfuran-3-yl)disulfanyl]-2,5-dimethylfuran |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 305.3ºC at 760mmHg |
| Molecular Formula | C12H14O2S2 |
| Molecular Weight | 254.36800 |
| Flash Point | 138.5ºC |
| Exact Mass | 254.04400 |
| PSA | 76.88000 |
| LogP | 4.90560 |
| Appearance of Characters | NA |
| Vapour Pressure | 0.00149mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | JDWCALSZHJBMIQ-UHFFFAOYSA-N |
| SMILES | Cc1cc(SSc2cc(C)oc2C)c(C)o1 |
| Storage condition | 2-8°C |
| HS Code | 2932190090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| UNII-Y4J0329QJ8 |
| 3,3'-Dithiobis(2,5-dimethylfuran) |
| bis(2,5-dimethyl-3-furyl) disulfide |
| FEMA No. 3476 |
| 3,3'-Bis-(2,5-dimethylfuryl)-disulphide |
| bis (2,5-dimethyl-furan-3-yl)-disulfide |
| furan,3,3'-dithiobis[2,5-dimethyl |