1,3-Benzodioxole,5-[[1-(2-chloroethoxy)ethoxy]methyl]
Modify Date: 2025-09-18 15:13:03
![1,3-Benzodioxole,5-[[1-(2-chloroethoxy)ethoxy]methyl] Structure](https://image.chemsrc.com/caspic/210/2859-77-0.png)
1,3-Benzodioxole,5-[[1-(2-chloroethoxy)ethoxy]methyl] structure
|
Common Name | 1,3-Benzodioxole,5-[[1-(2-chloroethoxy)ethoxy]methyl] | ||
|---|---|---|---|---|
| CAS Number | 2859-77-0 | Molecular Weight | 258.69800 | |
| Density | 1.247g/cm3 | Boiling Point | 336.8ºC at 760mmHg | |
| Molecular Formula | C12H15ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123ºC | |
| Name | 5-((1-(2-chloroethoxy)ethoxy)methyl)benzo[d][1,3]dioxole |
|---|
| Density | 1.247g/cm3 |
|---|---|
| Boiling Point | 336.8ºC at 760mmHg |
| Molecular Formula | C12H15ClO4 |
| Molecular Weight | 258.69800 |
| Flash Point | 123ºC |
| Exact Mass | 258.06600 |
| PSA | 36.92000 |
| LogP | 2.53330 |
| Vapour Pressure | 0.000214mmHg at 25°C |
| Index of Refraction | 1.53 |
| InChIKey | SCBJLRVFLDVAKT-UHFFFAOYSA-N |
| SMILES | CC(OCCCl)OCc1ccc2c(c1)OCO2 |
|
~%
1,3-Benzodioxol... CAS#:2859-77-0 |
| Literature: Gertler et al. Journal of Organic Chemistry, 1959 , vol. 24, p. 327 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
Total 1, Current Page 1 of 1
1