N-(9-FLUORENYLMETHOXYCARBONYL)GLYCINE- structure
|
Common Name | N-(9-FLUORENYLMETHOXYCARBONYL)GLYCINE- | ||
|---|---|---|---|---|
| CAS Number | 285978-13-4 | Molecular Weight | 300.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C1513C2H1515NO4 | Melting Point | 174-175ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of N-(9-FLUORENYLMETHOXYCARBONYL)GLYCINE-Fmoc-Gly-OH-13C2,15N is a 15N-labeled and 13C-labled Crystal Violet. Crystal violet (Basic Violet 3) is a triarylmethane dye. Crystal Violet (Gentian Violet) has antiviral effects against H1N1 and also has prominent bactericidal activities. |
| Name | N-(9-Fluorenylmethoxycarbonyl)-glycine-13C2,15N |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-Gly-OH-13C2,15N is a 15N-labeled and 13C-labled Crystal Violet. Crystal violet (Basic Violet 3) is a triarylmethane dye. Crystal Violet (Gentian Violet) has antiviral effects against H1N1 and also has prominent bactericidal activities. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[75]. |
| References |
| Melting Point | 174-175ºC(lit.) |
|---|---|
| Molecular Formula | C1513C2H1515NO4 |
| Molecular Weight | 300.28 |
| Exact Mass | 300.10400 |
| PSA | 79.12000 |
| LogP | 2.81410 |
| InChIKey | NDKDFTQNXLHCGO-KBBTWOTBSA-N |
| SMILES | O=C(O)CNC(=O)OCC1c2ccccc2-c2ccccc21 |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
| Fmoc-Gly-OH-13C2,15N |
| MFCD01075396 |
| Glycine-13C2,15N,N-Fmoc |