2,3-Butanedione,2,3-di-2-phenylhydrazone structure
|
Common Name | 2,3-Butanedione,2,3-di-2-phenylhydrazone | ||
|---|---|---|---|---|
| CAS Number | 2861-48-5 | Molecular Weight | 266.34100 | |
| Density | 1.06g/cm3 | Boiling Point | 398.2ºC at 760mmHg | |
| Molecular Formula | C16H18N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.6ºC | |
| Name | N-[(E)-[(3Z)-3-(phenylhydrazinylidene)butan-2-ylidene]amino]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 398.2ºC at 760mmHg |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.34100 |
| Flash Point | 194.6ºC |
| Exact Mass | 266.15300 |
| PSA | 48.78000 |
| LogP | 4.10840 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | NZSWAHHZVCLNEC-SIJTWYJSSA-N |
| SMILES | CC(=NNc1ccccc1)C(C)=NNc1ccccc1 |
| HS Code | 2928000090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Diacetyl-bisphenylhydrazon |
| diacetyldi(phenylhydrazone) |
| biacetyl bis(phenylhydrazone) |
| 2,3-Butanedione bis(phenylhydrazone) |
| diacetyl bis(phenylhydrazone) |
| Butane-2,3-dione bis(phenyl)hydrazone |