(5-nitroindazol-1-yl)-(3,4,5-trimethoxyphenyl)methanone structure
|
Common Name | (5-nitroindazol-1-yl)-(3,4,5-trimethoxyphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 28611-06-5 | Molecular Weight | 357.31800 | |
| Density | 1.39g/cm3 | Boiling Point | 587.8ºC at 760mmHg | |
| Molecular Formula | C17H15N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 309.3ºC | |
| Name | (5-nitroindazol-1-yl)-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 587.8ºC at 760mmHg |
| Molecular Formula | C17H15N3O6 |
| Molecular Weight | 357.31800 |
| Flash Point | 309.3ºC |
| Exact Mass | 357.09600 |
| PSA | 108.40000 |
| LogP | 3.18200 |
| Vapour Pressure | 8.49E-14mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | OKJNWAUJIAZUNF-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)n2ncc3cc([N+](=O)[O-])ccc32)cc(OC)c1OC |
| HS Code | 2933990090 |
|---|
|
~40%
(5-nitroindazol... CAS#:28611-06-5 |
| Literature: Recabarren-Gajardo; Gacitaa; Murueva; Romero; Espinosa-Bustos; Mella-Raipan; Del Valle; Pessoa-Mahana; Tapia Journal of Physical Organic Chemistry, 2011 , vol. 24, # 12 p. 1179 - 1187 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-nitro-1-(3,4,5-trimethoxy-benzoyl)-1H-indazole |
| 1H-Indazole,5-nitro-1-(3,4,5-trimethoxybenzoyl) |
| (Trimethoxy-3',4',5' benzoyl)-1 nitro-5 indazole [French] |
| 1-(3,4,5-trimethoxybenzoyl)-5-nitro-1H-indazole |