2,3-dimethyl-1,4-naphthoquinol-1-dimethylphosphate structure
|
Common Name | 2,3-dimethyl-1,4-naphthoquinol-1-dimethylphosphate | ||
|---|---|---|---|---|
| CAS Number | 28614-34-8 | Molecular Weight | 296.25600 | |
| Density | 1.277g/cm3 | Boiling Point | 422.2ºC at 760mmHg | |
| Molecular Formula | C14H17O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.1ºC | |
| Name | (4-hydroxy-2,3-dimethylnaphthalen-1-yl) dimethyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.277g/cm3 |
|---|---|
| Boiling Point | 422.2ºC at 760mmHg |
| Molecular Formula | C14H17O5P |
| Molecular Weight | 296.25600 |
| Flash Point | 209.1ºC |
| Exact Mass | 296.08100 |
| PSA | 74.80000 |
| LogP | 3.94190 |
| Vapour Pressure | 1E-07mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | KVJLCHMLOOQFGO-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)Oc1c(C)c(C)c(O)c2ccccc12 |
| HS Code | 2919900090 |
|---|
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 2,3-Dimethyl-1,4-naphthoquinol-1-dimethylphosphate |
| 4-hydroxy-2,3-dimethylnaphthalen-1-yl dimethyl phosphate |
| 2,3-Dimethyl-1,4-naphthochinol-1-dimethylphosphat |
| Dmnq-dmp |
| Phosphoric acid,4-hydroxy-2,3-dimethyl-1-naphthalenyl dimethyl ester |