Epoxylathyrol structure
|
Common Name | Epoxylathyrol | ||
|---|---|---|---|---|
| CAS Number | 28649-60-7 | Molecular Weight | 350.449 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 542.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H30O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.9±23.6 °C | |
Use of EpoxylathyrolEpoxylathyrol, an epoxylathyrane derivative isolated from the Euphorbia boetica, is a P-glycoprotein (P-gp) inhibitor. Epoxylathyrol is a P-gp-mediated multidrug resistance (MDR) reverser[1][2]. |
| Name | 6,20-Epoxylathyrol |
|---|---|
| Synonym | More Synonyms |
| Description | Epoxylathyrol, an epoxylathyrane derivative isolated from the Euphorbia boetica, is a P-glycoprotein (P-gp) inhibitor. Epoxylathyrol is a P-gp-mediated multidrug resistance (MDR) reverser[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Epoxylathyrol has no significant antiproliferative activity in EPG85-257P (parental; IC50>100 uM), EPG85-257RNOV (multidrug resistance [MDR] phenotype; IC50>100 uM), and EPG85-257RDB (multidrug resistance [MDR] phenotype; IC50=70.53 uM)[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 542.3±50.0 °C at 760 mmHg |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.449 |
| Flash Point | 190.9±23.6 °C |
| Exact Mass | 350.209320 |
| PSA | 90.29000 |
| LogP | 1.62 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | VEFQDSXSELSHMX-QVTWHFOYSA-N |
| SMILES | CC1=CC2C(CCC3(CO3)C(O)C3C(O)C(C)CC3(O)C1=O)C2(C)C |
| Storage condition | 2-8C |
| Epoxylathyrol |
| Spiro[9H-cyclopenta[a]cyclopropa[f]cycloundecene-9,2'-oxiran]-4(1H)-one, 1a,4a,5,6,7,7a,8,10,11,11a-decahydro-4a,7,8-trihydroxy-1,1,3,6-tetramethyl-, (1aR,2Z,4aR,6S,7S,7aR,8S,9R,11aS)- |
| Spiro[9H-cyclopenta[a]cyclopropa[f]cycloundecene-9,2'-oxiran]-4(1H)-one, 1a,4a,5,6,7,7a,8,10,11,11a-decahydro-4a,7,8-trihydroxy-1,1,3,6-tetramethyl-, (1aR,2E,4aR,6S,7S,7aR,8S,9R,11aS)- |
| (1aR,2Z,4aR,6S,7S,7aR,8S,9R,11aS)-4a,7,8-Trihydroxy-1,1,3,6-tetramethyl-1a,4a,5,6,7,7a,8,10,11,11a-decahydrospiro[cyclopenta[a]cyclopropa[f][11]annulene-9,2'-oxiran]-4(1H)-one |
| (1aR,2E,4aR,6S,7S,7aR,8S,9R,11aS)-4a,7,8-Trihydroxy-1,1,3,6-tetramethyl-1a,4a,5,6,7,7a,8,10,11,11a-decahydrospiro[cyclopenta[a]cyclopropa[f][11]annulene-9,2'-oxiran]-4(1H)-one |