({3-[(2-Fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl}methyl)(methyl)amine hydrochloride structure
|
Common Name | ({3-[(2-Fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl}methyl)(methyl)amine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2866335-01-3 | Molecular Weight | 257.69 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13ClFN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ({3-[(2-Fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl}methyl)(methyl)amine hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H13ClFN3O |
|---|---|
| Molecular Weight | 257.69 |
| InChIKey | CEOXPXJLXIYMKJ-UHFFFAOYSA-N |
| SMILES | CNCc1nc(Cc2ccccc2F)no1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2866335-01-3? |
| A: Chinese name of 2866335-01-3 is 2866335-01-3. |
| Q: What is the molecular weight of ({3-[(2-Fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl}methyl)(methyl)amine hydrochloride? |
| A: Molecular weight of ({3-[(2-Fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl}methyl)(methyl)amine hydrochloride is 257.69. |
| Q: What is the InChIKey of ({3-[(2-Fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl}methyl)(methyl)amine hydrochloride? |
| A: InChIKey of ({3-[(2-Fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl}methyl)(methyl)amine hydrochloride is CEOXPXJLXIYMKJ-UHFFFAOYSA-N. |
| Q: What is the CAS number of ({3-[(2-Fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl}methyl)(methyl)amine hydrochloride? |
| A: CAS number of ({3-[(2-Fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl}methyl)(methyl)amine hydrochloride is 2866335-01-3. |
| Q: What is the molecular formula of ({3-[(2-Fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl}methyl)(methyl)amine hydrochloride? |
| A: Molecular formula of ({3-[(2-Fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl}methyl)(methyl)amine hydrochloride is C11H13ClFN3O. |
| Q: What is the English name of ({3-[(2-Fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl}methyl)(methyl)amine hydrochloride? |
| A: The English name of ({3-[(2-Fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl}methyl)(methyl)amine hydrochloride is ({3-[(2-Fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl}methyl)(methyl)amine hydrochloride. |
| Q: What is the SMILES notation of ({3-[(2-Fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl}methyl)(methyl)amine hydrochloride? |
| A: SMILES notation of ({3-[(2-Fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl}methyl)(methyl)amine hydrochloride is CNCc1nc(Cc2ccccc2F)no1.Cl. |