Cyclobutaneacetic acid,3-carboxy-2,2-dimethyl
Cyclobutaneacetic acid,3-carboxy-2,2-dimethyl structure
|
Common Name | Cyclobutaneacetic acid,3-carboxy-2,2-dimethyl | ||
|---|---|---|---|---|
| CAS Number | 28664-02-0 | Molecular Weight | 186.20500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Pinic acid, also known as Cyclobutaneacetic acid,3-carboxy-2,2-dimethyl-, has a CAS number of 28664-02-0, with a molecular formula of C9H14O4 and a molecular weight of 186.20500. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Pinic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H14O4 |
|---|---|
| Molecular Weight | 186.20500 |
| Exact Mass | 186.08900 |
| PSA | 74.60000 |
| LogP | 1.20800 |
| InChIKey | LEVONNIFUFSRKZ-UHFFFAOYSA-N |
| SMILES | CC1(C(CC1C(=O)O)CC(=O)O)C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:28664-03-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (3-Carboxy-2,2-dimethyl-cyclobutyl)-essigsaeure |
| (3-carboxy-2,2-dimethyl-cyclobutyl)-acetic acid |
| 1.1-Dimethylboran(6) |
| 1.1-Dimethyl-cyclobutan-carbonsaeure-(2)-essigsaeure-(4) |
| 1,1-DIMETHYLDIBORANE |
| 2,2-Dimethyl-3-carboxymethyl-cyclobutan-carbonsaeure-(1) |
| 1.1-dimethyl borane(6) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Pinic acid? |
| A: SMILES notation of Pinic acid is CC1(C(CC1C(=O)O)CC(=O)O)C. |
| Q: What are the downstream products of Pinic acid? |
| A: Related downstream products(CAS) of Pinic acid: 28664-03-1. |
| Q: What is the molecular weight of Pinic acid? |
| A: Molecular weight of Pinic acid is 186.20500. |
| Q: What is the molecular formula of Pinic acid? |
| A: Molecular formula of Pinic acid is C9H14O4. |
| Q: What is the English name of Pinic acid? |
| A: The English name of Pinic acid is Pinic acid. |
| Q: What is the InChIKey of Pinic acid? |
| A: InChIKey of Pinic acid is LEVONNIFUFSRKZ-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of Pinic acid? |
| A: Polar surface area (PSA) of Pinic acid is 74.60000. |
| Q: What is the LogP of Pinic acid? |
| A: LogP of Pinic acid is 1.20800. |
| Q: What English synonyms does Pinic acid have? |
| A: English synonyms of Pinic acid: (3-Carboxy-2,2-dimethyl-cyclobutyl)-essigsaeure, (3-carboxy-2,2-dimethyl-cyclobutyl)-acetic acid, 1.1-Dimethylboran(6), 1.1-Dimethyl-cyclobutan-carbonsaeure-(2)-essigsaeure-(4), 1,1-DIMETHYLDIBORANE, 2,2-Dimethyl-3-carboxymethyl-cyclobutan-carbonsaeure-(1), 1.1-dimethyl borane(6). |
| Q: What is the CAS number of Pinic acid? |
| A: CAS number of Pinic acid is 28664-02-0. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |