2-Methyl-4-nitroquinoline structure
|
Common Name | 2-Methyl-4-nitroquinoline | ||
|---|---|---|---|---|
| CAS Number | 28673-36-1 | Molecular Weight | 188.18300 | |
| Density | 1.298g/cm3 | Boiling Point | 330.4ºC at 760mmHg | |
| Molecular Formula | C10H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.6ºC | |
| Name | 2-Methyl-4-nitroquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.298g/cm3 |
|---|---|
| Boiling Point | 330.4ºC at 760mmHg |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.18300 |
| Flash Point | 153.6ºC |
| Exact Mass | 188.05900 |
| PSA | 58.71000 |
| LogP | 2.97460 |
| Vapour Pressure | 0.000321mmHg at 25°C |
| Index of Refraction | 1.661 |
| InChIKey | VPADYBIJEXXKLO-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])c2ccccc2n1 |
| HS Code | 2933499090 |
|---|
|
~%
2-Methyl-4-nitr... CAS#:28673-36-1 |
| Literature: Zhou, Yu; Li, Jian; Liu, Hong; Zhao, Linxiang; Jiang, Hualiang Tetrahedron Letters, 2006 , vol. 47, # 48 p. 8511 - 8514 |
|
~%
2-Methyl-4-nitr... CAS#:28673-36-1 |
| Literature: Zhou, Yu; Li, Jian; Liu, Hong; Zhao, Linxiang; Jiang, Hualiang Tetrahedron Letters, 2006 , vol. 47, # 48 p. 8511 - 8514 |
|
~%
2-Methyl-4-nitr... CAS#:28673-36-1 |
| Literature: Zhou, Yu; Li, Jian; Liu, Hong; Zhao, Linxiang; Jiang, Hualiang Tetrahedron Letters, 2006 , vol. 47, # 48 p. 8511 - 8514 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-4-nitrochinolin |
| 2-methyl-4-nitro-quinoline |
| Quinoline,2-methyl-4-nitro |
| 4-Nitrochinaldin |
| Quinaldine,4-nitro-(8CI) |