1-Cyclohexene-1-acetic acid, 4-cyclohexyl-alpha-methyl- structure
|
Common Name | 1-Cyclohexene-1-acetic acid, 4-cyclohexyl-alpha-methyl- | ||
|---|---|---|---|---|
| CAS Number | 28673-51-0 | Molecular Weight | 236.35000 | |
| Density | 1.052g/cm3 | Boiling Point | 362.4ºC at 760mmHg | |
| Molecular Formula | C15H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.3ºC | |
| Name | 2-(4-cyclohexylcyclohexen-1-yl)propanoic acid |
|---|
| Density | 1.052g/cm3 |
|---|---|
| Boiling Point | 362.4ºC at 760mmHg |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35000 |
| Flash Point | 259.3ºC |
| Exact Mass | 236.17800 |
| PSA | 37.30000 |
| LogP | 4.01390 |
| Vapour Pressure | 3.08E-06mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | VKNIBPAITNJYAK-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)C1=CCC(C2CCCCC2)CC1 |
| HS Code | 2916209090 |
|---|
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |