4-Cyclohexyl-alpha-ethyl-1-cyclohexene-1-acetic acid
Modify Date: 2025-08-24 23:31:01
4-Cyclohexyl-alpha-ethyl-1-cyclohexene-1-acetic acid structure
|
Common Name | 4-Cyclohexyl-alpha-ethyl-1-cyclohexene-1-acetic acid | ||
|---|---|---|---|---|
| CAS Number | 28673-54-3 | Molecular Weight | 250.37600 | |
| Density | 1.038g/cm3 | Boiling Point | 376.7ºC at 760mmHg | |
| Molecular Formula | C16H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.6ºC | |
| Name | 2-(4-cyclohexylcyclohexen-1-yl)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.038g/cm3 |
|---|---|
| Boiling Point | 376.7ºC at 760mmHg |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.37600 |
| Flash Point | 273.6ºC |
| Exact Mass | 250.19300 |
| PSA | 37.30000 |
| LogP | 4.40400 |
| Vapour Pressure | 1.03E-06mmHg at 25°C |
| Index of Refraction | 1.517 |
| InChIKey | NJZIUJMBNASWAI-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)O)C1=CCC(C2CCCCC2)CC1 |
| HS Code | 2916209090 |
|---|
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Butanoic acid,2-(4-cyclohexyl-1-cyclohexen-1-yl) |