6-Chloro-2-(2-hydroxyphenyl)quinazoline-4(3H)-one structure
|
Common Name | 6-Chloro-2-(2-hydroxyphenyl)quinazoline-4(3H)-one | ||
|---|---|---|---|---|
| CAS Number | 28683-81-0 | Molecular Weight | 272.68600 | |
| Density | 1.44g/cm3 | Boiling Point | 557.8ºC at 760mmHg | |
| Molecular Formula | C14H9ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.1ºC | |
| Name | (2Z)-6-chloro-2-(6-oxocyclohexa-2,4-dien-1-ylidene)-1H-quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 557.8ºC at 760mmHg |
| Molecular Formula | C14H9ClN2O2 |
| Molecular Weight | 272.68600 |
| Flash Point | 291.1ºC |
| Exact Mass | 272.03500 |
| PSA | 65.98000 |
| LogP | 2.04880 |
| Vapour Pressure | 1.78E-12mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | MOKNCCJRANEBEU-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(-c2ccccc2O)nc2ccc(Cl)cc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-chloro-2-(2-hydroxyphenyl)-4(3H)-quinazolinone |
| 6-Chloro-2-(2-hydroxyphenyl)-4(1H)-quinazolinone |
| 4(1H)-Quinazolinone,6-chloro-2-(2-hydroxyphenyl) |
| 2-o-Hydroxyphenyl-6-chlor-4(3H)-chinazolinon |
| 6-chloro-2-(2-hydroxy-phenyl)-3H-quinazolin-4-one |
| 4(3H)-Quinazolinone,6-chloro-2-(2-hydroxyphenyl) |