2-(5-Chloro-2-hydroxyphenyl)-6-nitro-4(1H)-quinazolinone structure
|
Common Name | 2-(5-Chloro-2-hydroxyphenyl)-6-nitro-4(1H)-quinazolinone | ||
|---|---|---|---|---|
| CAS Number | 28683-91-2 | Molecular Weight | 317.68400 | |
| Density | 1.62g/cm3 | Boiling Point | 544.8ºC at 760 mmHg | |
| Molecular Formula | C14H8ClN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.3ºC | |
| Name | (2E)-2-(3-chloro-6-oxocyclohexa-2,4-dien-1-ylidene)-6-nitro-1H-quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 544.8ºC at 760 mmHg |
| Molecular Formula | C14H8ClN3O4 |
| Molecular Weight | 317.68400 |
| Flash Point | 283.3ºC |
| Exact Mass | 317.02000 |
| PSA | 111.80000 |
| LogP | 2.39330 |
| Vapour Pressure | 6.28E-12mmHg at 25°C |
| Index of Refraction | 1.72 |
| InChIKey | XXXZIZFJHWLBKC-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(-c2cc(Cl)ccc2O)nc2ccc([N+](=O)[O-])cc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4(3H)-Quinazolinone,2-(5-chloro-2-hydroxyphenyl)-6-nitro |
| 4(1H)-Quinazolinone,2-(5-chloro-2-hydroxyphenyl)-6-nitro |
| 2-(5-Chloro-2-hydroxyphenyl)-6-nitro-4-(1H)-quinazolinone |