methyl 2-(4,5-dichloro-2-nitrophenyl)acetate structure
|
Common Name | methyl 2-(4,5-dichloro-2-nitrophenyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 286949-63-1 | Molecular Weight | 264.06200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-(4,5-dichloro-2-nitrophenyl)acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H7Cl2NO4 |
|---|---|
| Molecular Weight | 264.06200 |
| Exact Mass | 262.97500 |
| PSA | 72.12000 |
| LogP | 3.14030 |
| InChIKey | UXNCYKUTRKLPRH-UHFFFAOYSA-N |
| SMILES | COC(=O)Cc1cc(Cl)c(Cl)cc1[N+](=O)[O-] |
| HS Code | 2916399090 |
|---|
|
~80%
methyl 2-(4,5-d... CAS#:286949-63-1 |
| Literature: Chen, Jiong J.; Wei, Yuan; Drach, John C.; Townsend, Leroy B. Journal of Medicinal Chemistry, 2000 , vol. 43, # 12 p. 2449 - 2456 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| methyldichloronitrophenylacetate |
| 4,5-dichloro-2-nitrophenylacetic acid methyl ester |