N-methyl-N-{[2-(propan-2-yl)-1,3-thiazol-4-yl]methyl}sulfamoyl chloride
Modify Date: 2026-07-17 15:49:05
![N-methyl-N-{[2-(propan-2-yl)-1,3-thiazol-4-yl]methyl}sulfamoyl chloride Structure](https://www.chemsrc.com/extcaspic/372/2870682-00-9.png)
N-methyl-N-{[2-(propan-2-yl)-1,3-thiazol-4-yl]methyl}sulfamoyl chloride structure
|
Common Name | N-methyl-N-{[2-(propan-2-yl)-1,3-thiazol-4-yl]methyl}sulfamoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 2870682-00-9 | Molecular Weight | 268.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H13ClN2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-methyl-N-{[2-(propan-2-yl)-1,3-thiazol-4-yl]methyl}sulfamoyl chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H13ClN2O2S2 |
|---|---|
| Molecular Weight | 268.8 |
| InChIKey | UYFIVRSCIPAOCQ-UHFFFAOYSA-N |
| SMILES | CC(C)c1nc(CN(C)S(=O)(=O)Cl)cs1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-methyl-N-{[2-(propan-2-yl)-1,3-thiazol-4-yl]methyl}sulfamoyl chloride? |
| A: The English name of N-methyl-N-{[2-(propan-2-yl)-1,3-thiazol-4-yl]methyl}sulfamoyl chloride is N-methyl-N-{[2-(propan-2-yl)-1,3-thiazol-4-yl]methyl}sulfamoyl chloride. |
| Q: What is the SMILES notation of N-methyl-N-{[2-(propan-2-yl)-1,3-thiazol-4-yl]methyl}sulfamoyl chloride? |
| A: SMILES notation of N-methyl-N-{[2-(propan-2-yl)-1,3-thiazol-4-yl]methyl}sulfamoyl chloride is CC(C)c1nc(CN(C)S(=O)(=O)Cl)cs1. |
| Q: What is the molecular weight of N-methyl-N-{[2-(propan-2-yl)-1,3-thiazol-4-yl]methyl}sulfamoyl chloride? |
| A: Molecular weight of N-methyl-N-{[2-(propan-2-yl)-1,3-thiazol-4-yl]methyl}sulfamoyl chloride is 268.8. |
| Q: What is the molecular formula of N-methyl-N-{[2-(propan-2-yl)-1,3-thiazol-4-yl]methyl}sulfamoyl chloride? |
| A: Molecular formula of N-methyl-N-{[2-(propan-2-yl)-1,3-thiazol-4-yl]methyl}sulfamoyl chloride is C8H13ClN2O2S2. |
| Q: What is the InChIKey of N-methyl-N-{[2-(propan-2-yl)-1,3-thiazol-4-yl]methyl}sulfamoyl chloride? |
| A: InChIKey of N-methyl-N-{[2-(propan-2-yl)-1,3-thiazol-4-yl]methyl}sulfamoyl chloride is UYFIVRSCIPAOCQ-UHFFFAOYSA-N. |
| Q: What is the CAS number of N-methyl-N-{[2-(propan-2-yl)-1,3-thiazol-4-yl]methyl}sulfamoyl chloride? |
| A: CAS number of N-methyl-N-{[2-(propan-2-yl)-1,3-thiazol-4-yl]methyl}sulfamoyl chloride is 2870682-00-9. |
| Q: What is the Chinese name of 2870682-00-9? |
| A: Chinese name of 2870682-00-9 is 2870682-00-9. |