1H-Imidazole-1,2-diamine,4-phenyl-N1-(phenylmethylene)- structure
|
Common Name | 1H-Imidazole-1,2-diamine,4-phenyl-N1-(phenylmethylene)- | ||
|---|---|---|---|---|
| CAS Number | 28734-00-1 | Molecular Weight | 262.30900 | |
| Density | 1.18g/cm3 | Boiling Point | 514.7ºC at 760mmHg | |
| Molecular Formula | C16H14N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.1ºC | |
| Name | 1-(benzylideneamino)-4-phenylimidazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 514.7ºC at 760mmHg |
| Molecular Formula | C16H14N4 |
| Molecular Weight | 262.30900 |
| Flash Point | 265.1ºC |
| Exact Mass | 262.12200 |
| PSA | 56.20000 |
| LogP | 3.59570 |
| Vapour Pressure | 1.06E-10mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | WWRNHYJLVIXUEJ-WOJGMQOQSA-N |
| SMILES | Nc1nc(-c2ccccc2)cn1N=Cc1ccccc1 |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N1-benzylidene-4-phenyl-imidazole-1,2-diamine |
| 2-amino-1-benzylideneamino-4-phenyl-1H-imidazole |
| 2-Amino-1-benzylidenamino-4-phenyl-imidazol |
| 2-amino-1-benzyl-4,5-diphenyl-1H-pyrrole-3-carbonitrile |
| 2-amino-1-benzylideneamino-4-phenylimidazole |
| 2-amino-4,5-diphenyl-1-benzyl-3-cyano-pyrrole |
| 2-amino-1-benzyl-4,5-diphenyl-pyrrole-3-carbonitrile |
| aminobenzyldiphenylpyrrolecarbonitrile |
| 2-amino-1-benzylidenamino-4-phenylimidazole |