4,5,6,7-tetrahydro-3-phenyl-1H-indazole structure
|
Common Name | 4,5,6,7-tetrahydro-3-phenyl-1H-indazole | ||
|---|---|---|---|---|
| CAS Number | 28748-99-4 | Molecular Weight | 198.26400 | |
| Density | 1.145g/cm3 | Boiling Point | 431.6ºC at 760mmHg | |
| Molecular Formula | C13H14N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205ºC | |
| Name | 3-phenyl-4,5,6,7-tetrahydro-1H-indazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.145g/cm3 |
|---|---|
| Boiling Point | 431.6ºC at 760mmHg |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.26400 |
| Flash Point | 205ºC |
| Exact Mass | 198.11600 |
| PSA | 28.68000 |
| LogP | 2.95550 |
| Vapour Pressure | 2.98E-07mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | HZICBKDUOSCVSH-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2n[nH]c3c2CCCC3)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,5,6,7-Tetrahydro-3-phenyl-1H-indazole |
| 3-phenyl-4,5,6,7-tetrahydroindazole |
| EINECS 249-195-6 |
| 3-phenyl-4,5,6,7-tetrahydro-2H-indazol |