N-tert-butyl-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]acetamide
Modify Date: 2026-07-08 16:33:48
![N-tert-butyl-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]acetamide Structure](https://www.chemsrc.com/extcaspic/269/2877655-75-7.png)
N-tert-butyl-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]acetamide structure
|
Common Name | N-tert-butyl-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 2877655-75-7 | Molecular Weight | 303.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H29N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-tert-butyl-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H29N3O |
|---|---|
| Molecular Weight | 303.4 |
| InChIKey | AIEJZADEOGTFQT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N2CCN(CC(=O)NC(C)(C)C)CC2)c(C)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-tert-butyl-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]acetamide? |
| A: SMILES notation of N-tert-butyl-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]acetamide is Cc1ccc(N2CCN(CC(=O)NC(C)(C)C)CC2)c(C)c1. |
| Q: What is the Chinese name of 2877655-75-7? |
| A: Chinese name of 2877655-75-7 is 2877655-75-7. |
| Q: What is the English name of N-tert-butyl-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]acetamide? |
| A: The English name of N-tert-butyl-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]acetamide is N-tert-butyl-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]acetamide. |
| Q: What is the InChIKey of N-tert-butyl-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]acetamide? |
| A: InChIKey of N-tert-butyl-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]acetamide is AIEJZADEOGTFQT-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-tert-butyl-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]acetamide? |
| A: Molecular formula of N-tert-butyl-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]acetamide is C18H29N3O. |
| Q: What is the CAS number of N-tert-butyl-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]acetamide? |
| A: CAS number of N-tert-butyl-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]acetamide is 2877655-75-7. |
| Q: What is the molecular weight of N-tert-butyl-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]acetamide? |
| A: Molecular weight of N-tert-butyl-2-[4-(2,4-dimethylphenyl)piperazin-1-yl]acetamide is 303.4. |